90429-80-4 Usage
Uses
Used in Pharmaceutical Research:
4-(2-Fluoro-phenyl)-4-oxo-butyric acid is utilized as a building block in organic synthesis and pharmaceutical research for its potential to contribute to the development of new drugs. Its unique structure allows it to be a key component in the creation of various medicinal compounds.
Used in Antiviral Applications:
In the medical field, 4-(2-Fluoro-phenyl)-4-oxo-butyric acid is used as an antiviral agent, leveraging its pharmacological properties to combat viral infections by interfering with viral replication or assembly processes.
Used in Anticancer Applications:
4-(2-Fluoro-phenyl)-4-oxo-butyric acid is employed as an anticancer agent, potentially targeting and inhibiting the growth of cancer cells through various mechanisms, contributing to cancer treatment and therapy.
Used in Anti-inflammatory and Analgesic Applications:
4-(2-Fluoro-phenyl)-4-oxo-butyric acid is used as an anti-inflammatory and analgesic agent, potentially reducing inflammation and alleviating pain by interacting with biological systems and pathways associated with these conditions.
Used in Organic Synthesis Industry:
In the chemical industry, 4-(2-Fluoro-phenyl)-4-oxo-butyric acid serves as a valuable intermediate in organic synthesis, enabling the production of a wide range of chemical products and specialty chemicals for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 90429-80-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,4,2 and 9 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 90429-80:
(7*9)+(6*0)+(5*4)+(4*2)+(3*9)+(2*8)+(1*0)=134
134 % 10 = 4
So 90429-80-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H9FO3/c11-8-4-2-1-3-7(8)9(12)5-6-10(13)14/h1-4H,5-6H2,(H,13,14)
