904326-91-6 Usage
Uses
Used in Organic Synthesis:
2-Fluoro-6-picoline-5-boronic acid is used as a building block in organic synthesis for the preparation of biologically active molecules. Its unique structure allows for the creation of diverse organic compounds with potential applications in various fields.
Used in Pharmaceutical Research:
In pharmaceutical research, 2-Fluoro-6-picoline-5-boronic acid is utilized as a key intermediate for the development of new drugs. Its ability to modify the electronic and steric properties of organic molecules contributes to the design and synthesis of novel therapeutic agents.
Used in Cross-Coupling Reactions:
2-Fluoro-6-picoline-5-boronic acid is employed as a reactant in cross-coupling reactions to form carbon-carbon bonds. This capability is crucial for the synthesis of complex organic molecules and the development of advanced materials.
Used in Drug Development:
2-Fluoro-6-picoline-5-boronic acid has the potential for applications in the development of new drugs. Its unique properties enable the creation of molecules with improved pharmacological profiles, including enhanced potency, selectivity, and bioavailability.
Used in Agrochemical Development:
In the agrochemical industry, 2-Fluoro-6-picoline-5-boronic acid can be used for the development of new pesticides and herbicides. Its ability to modify molecular properties allows for the design of more effective and environmentally friendly agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 904326-91-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,4,3,2 and 6 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 904326-91:
(8*9)+(7*0)+(6*4)+(5*3)+(4*2)+(3*6)+(2*9)+(1*1)=156
156 % 10 = 6
So 904326-91-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H7BFNO2/c1-4-5(7(10)11)2-3-6(8)9-4/h2-3,10-11H,1H3
