904696-62-4 Usage
Uses
Used in Pharmaceutical Industry:
1-[4-(AMINOMETHYL)BENZYL]-1H-PYRAZOLE HYDROCHLORIDE, TECH4-(1H-PYRAZOL-1-YLMETHYL)BENZYLAMINE HYDROCHLORIDE, are used as intermediates for the synthesis of pharmaceutical compounds, contributing to the development of new drugs due to their unique chemical structures and functional groups.
Used in Research Applications:
In research settings, these compounds are utilized as intermediates for the synthesis of various target molecules, aiding in the advancement of chemical and biological research, potentially leading to the discovery of novel compounds with specific therapeutic or biological properties.
Used in Organic Chemistry:
As building blocks in organic chemistry, 1-[4-(AMINOMETHYL)BENZYL]-1H-PYRAZOLE HYDROCHLORIDE, TECH4-(1H-PYRAZOL-1-YLMETHYL)BENZYLAMINE HYDROCHLORIDE, are employed in the construction of complex organic molecules, facilitating the exploration of new chemical reactions and the synthesis of innovative organic compounds.
Used in Specific Research or Industrial Settings:
Due to their potential biological activities or properties, these compounds may be used in specific research or industrial applications where their unique characteristics can be harnessed for particular purposes, such as in the development of new materials or processes.
Check Digit Verification of cas no
The CAS Registry Mumber 904696-62-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,4,6,9 and 6 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 904696-62:
(8*9)+(7*0)+(6*4)+(5*6)+(4*9)+(3*6)+(2*6)+(1*2)=194
194 % 10 = 4
So 904696-62-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H13N3.ClH/c12-8-10-2-4-11(5-3-10)9-14-7-1-6-13-14;/h1-7H,8-9,12H2;1H
