90471-66-2 Usage
Uses
Used in Pharmaceutical Industry:
4-Cbz-thiomorpholine-3-carboxylic acid is used as a key intermediate in the synthesis of drugs for the treatment of various diseases, such as cancer, inflammation, and microbial infections. Its unique structure and functional groups contribute to the development of novel therapeutic agents with improved efficacy and selectivity.
Used in Drug Synthesis:
4-Cbz-thiomorpholine-3-carboxylic acid is used as a building block in the preparation of pharmaceutical compounds. The presence of the carboxylic acid group allows for further chemical reactions, enabling the attachment of various functional groups to tailor the molecule's properties for specific therapeutic purposes.
Used in Medicinal Chemistry Research:
4-Cbz-thiomorpholine-3-carboxylic acid is employed as a valuable tool in medicinal chemistry research. Its unique structure and potential biological activity make it an attractive candidate for the design and optimization of new drug molecules, leading to the discovery of innovative therapeutic agents.
Used in Drug Development:
4-Cbz-thiomorpholine-3-carboxylic acid is utilized in the development of drugs targeting specific diseases. Its presence in the molecular structure can enhance the drug's potency, selectivity, and pharmacokinetic properties, contributing to the creation of more effective and safer medications.
Check Digit Verification of cas no
The CAS Registry Mumber 90471-66-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,4,7 and 1 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 90471-66:
(7*9)+(6*0)+(5*4)+(4*7)+(3*1)+(2*6)+(1*6)=132
132 % 10 = 2
So 90471-66-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H15NO4S/c15-12(16)11-9-19-7-6-14(11)13(17)18-8-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,15,16)
