904814-72-8 Usage
Uses
Used in Medicinal Chemistry:
3-Bromo-2-phenyl-imidazo[1,2-a]pyrimidine is used as a chemical intermediate for the development of new drugs, leveraging its ability to interact with biological targets such as receptors or enzymes. Its unique structural features make it a valuable component in the design and synthesis of pharmaceutical compounds with potential therapeutic applications.
Used in Drug Synthesis:
In the pharmaceutical industry, 3-Bromo-2-phenyl-imidazo[1,2-a]pyrimidine is used as a key building block in the synthesis of various organic compounds. Its presence in the molecular structure can enhance the biological activity and pharmacological properties of the resulting compounds, making it an essential component in drug discovery and development processes.
Used in Anticancer Applications:
3-Bromo-2-phenyl-imidazo[1,2-a]pyrimidine is used as an anticancer agent due to its potential to exhibit biological activities against cancer cells. Studies have shown that imidazo[1,2-a]pyrimidine derivatives can target and inhibit the growth of cancer cells, making them promising candidates for the development of novel anticancer drugs.
Used in Antiviral and Antibacterial Applications:
In the fields of virology and microbiology, 3-Bromo-2-phenyl-imidazo[1,2-a]pyrimidine is used as a potential antiviral and antibacterial agent. Its ability to exhibit biological activities against viruses and bacteria makes it a valuable compound for the development of new treatments and therapies to combat infectious diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 904814-72-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,4,8,1 and 4 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 904814-72:
(8*9)+(7*0)+(6*4)+(5*8)+(4*1)+(3*4)+(2*7)+(1*2)=168
168 % 10 = 8
So 904814-72-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H8BrN3/c13-11-10(9-5-2-1-3-6-9)15-12-14-7-4-8-16(11)12/h1-8H
