9050-67-3 Usage
Uses
Used in Oncology:
Schizophyllan is used as an immunostimulant in the management of carcinomas of the lungs, stomach, uterus, and breasts. It enhances the body's immune response to fight against cancer cells and can be used in combination with other antineoplastic treatments to improve the overall effectiveness of cancer therapy.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, Schizophyllan is used as a pharmaceutical excipient for the development of drug delivery systems. Its unique properties, such as biocompatibility and biodegradability, make it suitable for use in various drug formulations, including tablets, capsules, and injectables.
Used in Cosmetic Industry:
Schizophyllan is also used in the cosmetic industry as a thickening and stabilizing agent. Its ability to form gels and its compatibility with various cosmetic ingredients make it an ideal ingredient for creating skincare products, such as creams, lotions, and serums, that offer enhanced texture and stability.
Used in Food Industry:
In the food industry, Schizophyllan is used as a thickening, gelling, and emulsifying agent. Its ability to improve the texture and stability of food products makes it a valuable ingredient in the development of various food items, such as sauces, dressings, and beverages.
Overall, Schizophyllan is a versatile biopolymer with a wide range of applications in various industries, including pharmaceuticals, cosmetics, and food. Its unique properties and potential health benefits make it a valuable component in the development of innovative products and treatments.
Originator
Taito (Japan)
Check Digit Verification of cas no
The CAS Registry Mumber 9050-67-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 9,0,5 and 0 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 9050-67:
(6*9)+(5*0)+(4*5)+(3*0)+(2*6)+(1*7)=93
93 % 10 = 3
So 9050-67-3 is a valid CAS Registry Number.
InChI:InChI=1/C24H42O21/c25-1-5-9(28)13(32)15(34)22(41-5)39-4-8-12(31)20(45-23-16(35)14(33)10(29)6(2-26)42-23)18(37)24(43-8)44-19-11(30)7(3-27)40-21(38)17(19)36/h5-38H,1-4H2/t5-,6-,7-,8-,9-,10-,11-,12-,13+,14+,15-,16-,17-,18-,19+,20+,21-,22-,23+,24+/m1/s1