906352-58-7 Usage
General Description
Pentafluorophenyl 2-pyrid-3-yl-1,3-thiazole-4-carboxylate is a chemical compound with a complex structure that includes a pentafluorophenyl group, a 2-pyridyl group, and a 1,3-thiazole-4-carboxylate group. It is a heterocyclic compound with potential applications in pharmaceuticals and materials science. The pentafluorophenyl group is known for its electron-withdrawing properties, which can influence the reactivity and stability of the compound. The 2-pyridyl group is a common moiety in many biologically active compounds, while the 1,3-thiazole-4-carboxylate group is also found in various pharmaceuticals. Overall, the unique combination of these groups in the chemical "PENTAFLUOROPHENYL 2-PYRID-3-YL-1,3-THIAZOLE-4-CARBOXYLATE" makes it a potentially valuable compound for drug discovery and other applications.
Check Digit Verification of cas no
The CAS Registry Mumber 906352-58-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,6,3,5 and 2 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 906352-58:
(8*9)+(7*0)+(6*6)+(5*3)+(4*5)+(3*2)+(2*5)+(1*8)=167
167 % 10 = 7
So 906352-58-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H5F5N2O2S/c16-8-9(17)11(19)13(12(20)10(8)18)24-15(23)7-5-25-14(22-7)6-2-1-3-21-4-6/h1-5H