906352-60-1 Usage
General Description
2-[3-(Chloromethyl)phenyl]-1,3-thiazole is a chemical compound with the molecular formula C10H8ClNS. It is a thiazole derivative that contains a chlorine-methyl-phenyl group attached to the thiazole ring. 2-[3-(CHLOROMETHYL)PHENYL]-1,3-THIAZOLE is commonly used in the pharmaceutical industry as it possesses a wide range of biological activities and has the potential to be used as a pharmacophore for the development of new drugs. Additionally, it has been found to exhibit antifungal, antiviral, and antibacterial properties, making it a significant compound for medicinal research and drug development. Additionally, it is also used as a reference standard in various analytical testing and research applications.
Check Digit Verification of cas no
The CAS Registry Mumber 906352-60-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,6,3,5 and 2 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 906352-60:
(8*9)+(7*0)+(6*6)+(5*3)+(4*5)+(3*2)+(2*6)+(1*0)=161
161 % 10 = 1
So 906352-60-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H8ClNS/c11-7-8-2-1-3-9(6-8)10-12-4-5-13-10/h1-6H,7H2
