906352-71-4 Usage
Uses
Used in Organic Synthesis:
N-methyl-2-(tetrahydropyran-4-yloxy)benzylamine is used as a building block in organic synthesis for the creation of complex organic molecules. Its unique structure allows for versatile chemical reactions, facilitating the synthesis of a wide range of compounds.
Used in Pharmaceutical Research:
In the pharmaceutical industry, N-methyl-2-(tetrahydropyran-4-yloxy)benzylamine is utilized as an intermediate in the development of new drugs. Its presence in the molecular structure can influence the pharmacological properties of the final product, making it a valuable component in medicinal chemistry.
Used in Chemical Processes:
N-methyl-2-(tetrahydropyran-4-yloxy)benzylamine is employed in various chemical processes due to its reactivity and the ability to form different types of chemical bonds. This makes it suitable for use in the production of specialty chemicals and materials with specific properties.
Used in the Preparation of Biologically Active Molecules:
Given its role in the synthesis of biologically active molecules, N-methyl-2-(tetrahydropyran-4-yloxy)benzylamine is used in the development of compounds that can interact with biological systems. This can include the creation of potential therapeutic agents, diagnostic tools, or other bioactive substances.
Check Digit Verification of cas no
The CAS Registry Mumber 906352-71-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,6,3,5 and 2 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 906352-71:
(8*9)+(7*0)+(6*6)+(5*3)+(4*5)+(3*2)+(2*7)+(1*1)=164
164 % 10 = 4
So 906352-71-4 is a valid CAS Registry Number.
InChI:InChI=1/C13H19NO2/c1-14-10-11-4-2-3-5-13(11)16-12-6-8-15-9-7-12/h2-5,12,14H,6-10H2,1H3
