906352-82-7 Usage
General Description
1-(6-Methylpyrazin-2-yl)piperidine-4-carbaldehyde is a chemical compound with a molecular formula C13H17N3O. It is a derivative of piperidine and contains a pyrazine ring with a methyl group attached at the 6-position. The compound is an aldehyde, indicated by the carbaldehyde suffix, which means it contains a functional group consisting of a terminal carbonyl group attached to a hydrogen atom. This chemical may have various applications in organic and medicinal chemistry, including potential use in the synthesis of new compounds or as a building block for the development of pharmaceutical drugs. The specific properties and potential uses of 1-(6-Methylpyrazin-2-yl)piperidine-4-carbaldehyde would depend on the overall structure and reactivity of the molecule.
Check Digit Verification of cas no
The CAS Registry Mumber 906352-82-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,6,3,5 and 2 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 906352-82:
(8*9)+(7*0)+(6*6)+(5*3)+(4*5)+(3*2)+(2*8)+(1*2)=167
167 % 10 = 7
So 906352-82-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H15N3O/c1-9-6-12-7-11(13-9)14-4-2-10(8-15)3-5-14/h6-8,10H,2-5H2,1H3