906352-82-7 Usage
Derivative of piperidine
Yes
The compound is derived from piperidine, which is a heterocyclic amine and a common structural motif in many organic and medicinal compounds.
Pyrazine ring
Present
The compound contains a pyrazine ring, which is a six-membered nitrogen-containing aromatic ring.
Methyl group at the 6-position
Yes
A methyl group (CH3) is attached to the 6th position of the pyrazine ring, which can influence the compound's reactivity and properties.
Aldehyde functional group
Yes
The compound is an aldehyde, indicated by the carbaldehyde suffix. This means it contains a terminal carbonyl group (C=O) attached to a hydrogen atom.
Applications
Organic and medicinal chemistry
The compound may have various applications in organic and medicinal chemistry, such as being used in the synthesis of new compounds or as a building block for the development of pharmaceutical drugs.
Potential use in pharmaceuticals
Yes
Due to its unique structure and functional groups, the compound may be of interest for the development of new pharmaceutical drugs or as a precursor in the synthesis of bioactive molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 906352-82-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,6,3,5 and 2 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 906352-82:
(8*9)+(7*0)+(6*6)+(5*3)+(4*5)+(3*2)+(2*8)+(1*2)=167
167 % 10 = 7
So 906352-82-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H15N3O/c1-9-6-12-7-11(13-9)14-4-2-10(8-15)3-5-14/h6-8,10H,2-5H2,1H3
