90657-53-7 Usage
Uses
Used in Pharmaceutical Research:
Trans-4-Phenyl-L-proline hydrochloride is used as a research compound for the development of new drugs, particularly in the field of neuroscience and psychiatry. Its unique structure and properties contribute to the exploration of its potential therapeutic effects and mechanisms of action.
Used in Organic Synthesis:
In the field of organic synthesis, trans-4-Phenyl-L-proline hydrochloride is used as a building block or intermediate in the synthesis of complex organic molecules. Its stability and reactivity make it a valuable component in the creation of various chemical compounds.
Used in Drug Discovery:
Trans-4-Phenyl-L-proline hydrochloride is utilized as a tool in drug discovery processes, where its unique properties can be leveraged to identify new therapeutic targets and develop novel drug candidates with potential applications in treating neurological and psychiatric disorders.
Used in Chemical Reactions:
Due to its stability and reactivity, trans-4-Phenyl-L-proline hydrochloride is employed in various chemical reactions, where it can act as a catalyst, reagent, or intermediate to facilitate the formation of desired products or improve the efficiency of the reaction process.
Check Digit Verification of cas no
The CAS Registry Mumber 90657-53-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,6,5 and 7 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 90657-53:
(7*9)+(6*0)+(5*6)+(4*5)+(3*7)+(2*5)+(1*3)=147
147 % 10 = 7
So 90657-53-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H13NO2.ClH/c13-11(14)10-6-9(7-12-10)8-4-2-1-3-5-8;/h1-5,9-10,12H,6-7H2,(H,13,14);1H/t9?,10-;/m0./s1
