90662-12-7 Usage
Uses
Used in Pharmaceutical Industry:
4,6-dichloro-2-(methylthio)-7H-pyrrolo[2,3-d]pyrimidine is used as a lead compound for the development of new drugs, leveraging its biological activities and potential therapeutic properties. Its unique structure allows for the exploration of various chemical modifications to enhance its pharmacological effects and selectivity, making it a valuable asset in the discovery of novel therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical sector, 4,6-dichloro-2-(methylthio)-7H-pyrrolo[2,3-d]pyrimidine is utilized as a starting material or intermediate in the synthesis of pesticides and other agrochemicals. Its reactivity and chemical properties make it suitable for the development of compounds with pesticidal or herbicidal activities, contributing to the advancement of crop protection strategies.
Used in Medicinal Chemistry Research:
4,6-dichloro-2-(methylthio)-7H-pyrrolo[2,3-d]pyrimidine serves as a subject of study in medicinal chemistry, where researchers investigate its structure-activity relationships, mechanism of action, and potential applications in drug design. Its unique fused ring system and substituents provide a foundation for exploring the compound's interactions with biological targets and its potential as a therapeutic agent.
Used in Chemical Synthesis:
As a heterocyclic compound with a reactive chlorine and methylthio group, 4,6-dichloro-2-(methylthio)-7H-pyrrolo[2,3-d]pyrimidine is employed in chemical synthesis for the preparation of various derivatives. These derivatives can be further explored for their potential applications in different fields, such as pharmaceuticals, materials science, or as intermediates in the synthesis of other complex molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 90662-12-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,6,6 and 2 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 90662-12:
(7*9)+(6*0)+(5*6)+(4*6)+(3*2)+(2*1)+(1*2)=127
127 % 10 = 7
So 90662-12-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H5Cl2N3S/c1-13-7-11-5(9)3-2-4(8)10-6(3)12-7/h2H,1H3,(H,10,11,12)
