90674-09-2 Usage
Uses
Used in Pharmaceutical Research and Drug Development:
Ethyl 7-amino-5-hydroxypyrazolo[1,5-a]pyrimidine-3-carboxylate is used as a research compound for studying its potential therapeutic effects and mechanisms of action. Its unique structure allows it to target specific cellular processes and proteins, making it a promising candidate for the development of new drugs.
Used in Medicinal Chemistry:
Ethyl 7-amino-5-hydroxypyrazolo[1,5-a]pyrimidine-3-carboxylate is used as a building block in the synthesis of other organic compounds. Its versatile chemical properties enable it to be modified and combined with other molecules to create new compounds with potential therapeutic applications.
Used in the Development of New Drugs:
Due to its potential therapeutic applications and importance in medicinal chemistry, Ethyl 7-amino-5-hydroxypyrazolo[1,5-a]pyrimidine-3-carboxylate is being explored for its potential to be developed into new drugs for various medical conditions. Its ability to inhibit specific cellular processes and target proteins makes it a valuable compound in the search for novel treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 90674-09-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,6,7 and 4 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 90674-09:
(7*9)+(6*0)+(5*6)+(4*7)+(3*4)+(2*0)+(1*9)=142
142 % 10 = 2
So 90674-09-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N4O3/c1-2-16-9(15)5-4-11-13-6(10)3-7(14)12-8(5)13/h3-4H,2,10H2,1H3,(H,12,14)
