90674-84-3 Usage
Uses
Used in Pharmaceutical Industry:
2-AMINO-5-BROMO-3-PIPERIDIN-1-YLPYRAZINE is used as a key intermediate in the synthesis of various pyrazine derivatives, which are known to possess a range of biological activities. These derivatives can be further developed into potential therapeutic agents for the treatment of various diseases.
Used in Chemical Research:
In the field of chemical research, 2-AMINO-5-BROMO-3-PIPERIDIN-1-YLPYRAZINE serves as a versatile building block for the development of novel pyrazine-based compounds with potential applications in various industries, such as pharmaceuticals, agrochemicals, and materials science.
Used in Organic Synthesis:
2-AMINO-5-BROMO-3-PIPERIDIN-1-YLPYRAZINE is used as a synthetic intermediate for the preparation of complex organic molecules, including pharmaceuticals, agrochemicals, and other specialty chemicals. Its unique structural features allow for the efficient synthesis of a wide range of pyrazine-containing compounds with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 90674-84-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,6,7 and 4 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 90674-84:
(7*9)+(6*0)+(5*6)+(4*7)+(3*4)+(2*8)+(1*4)=153
153 % 10 = 3
So 90674-84-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H13BrN4/c10-7-6-12-8(11)9(13-7)14-4-2-1-3-5-14/h6H,1-5H2,(H2,11,12)
