906744-85-2 Usage
Uses
Used in Organic Synthesis:
2-Fluoro-6-methylpyridine-3-boronic acid is used as a reagent in cross-coupling reactions for the formation of carbon-carbon bonds. Its unique structure allows it to participate in palladium-catalyzed coupling reactions, which are crucial for constructing complex organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, 2-Fluoro-6-methylpyridine-3-boronic acid is utilized for the production of biologically active molecules. Its ability to form stable bonds with other organic compounds makes it a valuable intermediate in the synthesis of potential drug candidates.
Used in Agrochemical Industry:
Similarly, in the agrochemical industry, this boronic acid derivative is employed in the synthesis of active ingredients for pesticides and other agricultural chemicals, contributing to the development of effective crop protection agents.
Used in Materials Science:
2-Fluoro-6-methylpyridine-3-boronic acid has been studied for its potential applications in materials science. Its properties may contribute to the development of new materials with specific characteristics, such as improved stability or reactivity.
Used in Catalysis:
2-Fluoro-6-methylpyridine-3-boronic acid is also being explored for its applications in catalysis. Its ability to form bonds with other molecules can be leveraged to create catalysts that enhance the efficiency of various chemical reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 906744-85-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,6,7,4 and 4 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 906744-85:
(8*9)+(7*0)+(6*6)+(5*7)+(4*4)+(3*4)+(2*8)+(1*5)=192
192 % 10 = 2
So 906744-85-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H7BFNO2/c1-4-2-3-5(7(10)11)6(8)9-4/h2-3,10-11H,1H3
