90747-55-0 Usage
Uses
Used in Pharmaceutical Research and Drug Development:
3-(1H-Imidazol-2-yl)-piperidine is used as a key component in the synthesis of potential drug candidates due to its unique structure and properties. It aids in the creation of new therapeutic agents and biologically active molecules.
Used in Coordination Chemistry:
In the field of coordination chemistry, 3-(1H-Imidazol-2-yl)-piperidine serves as a ligand, playing a crucial role in the formation and stabilization of metal complexes.
Used in Organic Synthesis:
As a reagent in organic synthesis, 3-(1H-Imidazol-2-yl)-piperidine contributes to the advancement of chemical research by facilitating various chemical reactions and the production of novel compounds.
Overall, 3-(1H-Imidazol-2-yl)-piperidine is instrumental in the development of new drugs and the progression of chemical and pharmaceutical research.
Check Digit Verification of cas no
The CAS Registry Mumber 90747-55-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,7,4 and 7 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 90747-55:
(7*9)+(6*0)+(5*7)+(4*4)+(3*7)+(2*5)+(1*5)=150
150 % 10 = 0
So 90747-55-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H13N3/c1-2-7(6-9-3-1)8-10-4-5-11-8/h4-5,7,9H,1-3,6H2,(H,10,11)
