90766-92-0 Usage
Structure
The compound has a complex structure that includes a purine base and a pyrimidine ring.
Functional groups
It contains bromine, chlorine, and methylthio functional groups.
Potential applications
Due to its complex structure and the presence of various functional groups, the compound may have biological activity and could be useful in pharmaceutical research and development.
Further research
The properties and potential applications of 1H-Purin-2-amine, 6-[[5-bromo-6-chloro-2-(methylthio)-4-pyrimidinyl]th io]- require further investigation and research to fully understand its potential in drug design and discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 90766-92-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,7,6 and 6 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 90766-92:
(7*9)+(6*0)+(5*7)+(4*6)+(3*6)+(2*9)+(1*2)=160
160 % 10 = 0
So 90766-92-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H7BrClN7S2/c1-20-10-16-5(12)3(11)7(19-10)21-8-4-6(15-2-14-4)17-9(13)18-8/h2,4H,1H3,(H2,13,14,15,17)
