907958-42-3 Usage
Uses
Used in Organic Synthesis:
4-CHLORO-5-NITRO-(1H)INDAZOLE is used as a key intermediate in organic synthesis for the preparation of various chemical compounds. Its unique structure allows for further functionalization and modification, making it a valuable building block in the synthesis of complex organic molecules.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 4-CHLORO-5-NITRO-(1H)INDAZOLE is utilized as a starting material or a precursor in the development of new drugs. Its structural features can be exploited to design and synthesize novel therapeutic agents with potential applications in various medical fields.
Used in Medicinal Chemistry:
4-CHLORO-5-NITRO-(1H)INDAZOLE is employed as a versatile compound in medicinal chemistry for the exploration of its biological activities and potential therapeutic effects. Its unique chemical structure can be optimized to target specific biological pathways or receptors, leading to the discovery of new drugs with improved efficacy and safety profiles.
Used in Chemical Reactions:
Due to its reactivity and the presence of functional groups, 4-CHLORO-5-NITRO-(1H)INDAZOLE is used in various chemical reactions to form new compounds with different properties. Its versatility in undergoing different types of reactions, such as substitution, addition, or elimination, makes it a valuable tool in the synthesis of a wide range of chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 907958-42-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,7,9,5 and 8 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 907958-42:
(8*9)+(7*0)+(6*7)+(5*9)+(4*5)+(3*8)+(2*4)+(1*2)=213
213 % 10 = 3
So 907958-42-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H4ClN3O2/c8-7-4-3-9-10-5(4)1-2-6(7)11(12)13/h1-3H,(H,9,10)
