908600-75-9 Usage
Uses
Used in Pharmaceutical Research and Development:
7-Fluoro-1H-Indole-6-carboxylic acid is utilized as a precursor in the synthesis of various pharmaceuticals, contributing to the development of new drugs with potential therapeutic applications. Its unique structure allows for the creation of compounds that may exhibit novel pharmacological properties.
Used in Agrochemical Synthesis:
In the agrochemical industry, 7-Fluoro-1H-Indole-6-carboxylic acid serves as a key intermediate in the production of agrochemicals, such as pesticides and herbicides. Its incorporation into these compounds can lead to the development of more effective and targeted agricultural products.
Used in Organic Chemistry:
7-Fluoro-1H-Indole-6-carboxylic acid is employed as a building block in organic chemistry for the synthesis of complex organic molecules. Its reactivity and structural features make it a versatile component in the creation of a wide array of organic compounds for various applications.
Used in Drug Discovery:
Due to its potential biological activities, 7-Fluoro-1H-Indole-6-carboxylic acid is considered a candidate in drug discovery processes. It may lead to the identification of new bioactive molecules with therapeutic potential, contributing to advancements in medicine and healthcare.
Check Digit Verification of cas no
The CAS Registry Mumber 908600-75-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,8,6,0 and 0 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 908600-75:
(8*9)+(7*0)+(6*8)+(5*6)+(4*0)+(3*0)+(2*7)+(1*5)=169
169 % 10 = 9
So 908600-75-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H6FNO2/c10-7-6(9(12)13)2-1-5-3-4-11-8(5)7/h1-4,11H,(H,12,13)
