909092-64-4 Usage
Description
3-(5-METHYL-2-FURYL)-1H-PYRAZOLE-5-CARBOXYLIC ACID is a chemical compound characterized by its pyrazole ring fused with a methylfuryl group and a carboxylic acid functional group. This structure endows it with unique reactivity and properties, making it a valuable intermediate in organic synthesis and pharmaceutical chemistry.
Uses
Used in Pharmaceutical Industry:
3-(5-METHYL-2-FURYL)-1H-PYRAZOLE-5-CARBOXYLIC ACID is used as a reactant in the synthesis of amide compounds, specifically targeting the development of 17βHSD type 5 inhibitors. These inhibitors are of interest in medicinal chemistry due to their potential therapeutic applications, such as the treatment of hormonal disorders and certain types of cancers where 17βHSD type 5 enzymes play a crucial role in disease progression.
Check Digit Verification of cas no
The CAS Registry Mumber 909092-64-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,9,0,9 and 2 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 909092-64:
(8*9)+(7*0)+(6*9)+(5*0)+(4*9)+(3*2)+(2*6)+(1*4)=184
184 % 10 = 4
So 909092-64-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N2O3/c1-5-2-3-8(14-5)6-4-7(9(12)13)11-10-6/h2-4H,1H3,(H,10,11)(H,12,13)
