90994-17-5 Usage
Uses
Used in Pharmaceutical Industry:
6-Chloro-7H-pyrrolo[2,3-d]pyrimidine is used as a key intermediate in the synthesis of resorcinol N-aryl amide derivatives. These derivatives are known as pyruvate dehydrogenase kinase (PDK) inhibitors, which play a crucial role in regulating cellular metabolism and energy production. PDK inhibitors have potential therapeutic applications in the treatment of various diseases, including cancer and neurodegenerative disorders, by modulating metabolic pathways and energy homeostasis in cells.
Check Digit Verification of cas no
The CAS Registry Mumber 90994-17-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,9,9 and 4 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 90994-17:
(7*9)+(6*0)+(5*9)+(4*9)+(3*4)+(2*1)+(1*7)=165
165 % 10 = 5
So 90994-17-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H4ClN3/c7-5-1-4-2-8-3-9-6(4)10-5/h1-3H,(H,8,9,10)
