910041-10-0 Usage
Uses
Used in Pharmaceutical Industry:
Hydrazine, 1-ethyl-1-(2-methylphenyl)is used as an intermediate in the synthesis of various pharmaceuticals. Its unique chemical structure allows it to be a versatile building block for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, hydrazine, 1-ethyl-1-(2-methylphenyl)is utilized as an intermediate in the production of various agrochemicals, such as pesticides and herbicides. Its reactivity and ability to form stable compounds make it a valuable component in the synthesis of these products.
Used in Organic Synthesis:
Hydrazine, 1-ethyl-1-(2-methylphenyl)is employed as a reagent in organic synthesis, where it can participate in various chemical reactions, such as reduction, coupling, and cyclization. Its unique properties enable the formation of new compounds with potential applications in various fields.
Used in Dye and Pigment Manufacturing:
In the dye and pigment industry, hydrazine, 1-ethyl-1-(2-methylphenyl)is used in the production of various dyes and pigments. Its ability to form stable complexes with other molecules allows for the creation of vibrant and stable colorants for use in various applications, such as textiles, plastics, and printing inks.
Despite its wide range of applications, it is essential to recognize the potential health risks associated with hydrazine, 1-ethyl-1-(2-methylphenyl)-. Its high toxicity necessitates the implementation of strict safety protocols and the use of personal protective equipment when handling Hydrazine, 1-ethyl-1-(2-methylphenyl)-. Additionally, proper disposal and containment measures should be in place to minimize the risk of environmental contamination and exposure to humans and animals.
Check Digit Verification of cas no
The CAS Registry Mumber 910041-10-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,0,0,4 and 1 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 910041-10:
(8*9)+(7*1)+(6*0)+(5*0)+(4*4)+(3*1)+(2*1)+(1*0)=100
100 % 10 = 0
So 910041-10-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H14N2/c1-3-11(10)9-7-5-4-6-8(9)2/h4-7H,3,10H2,1-2H3
