91041-21-3 Usage
General Description
METHYL 3-(2-AMINOPHENOXY)-2-THIOPHENECARBOXYLATE is a chemical compound that is generally used in various fields of chemistry. This organic compound belongs to the group of anilides and phenyl thiophenes. It contains the functional groups of the ether, carboxylic ester, and amino groups. The presence of these groups gives it unique chemical properties. However, specific details about its uses, toxicity, and safety measures are not broadly documented, indicating it might be a specialized or less common substance in chemical synthesis or industrial applications. Therefore, careful handling and usage following safety guidelines are essential when using this compound in any chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 91041-21-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,1,0,4 and 1 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 91041-21:
(7*9)+(6*1)+(5*0)+(4*4)+(3*1)+(2*2)+(1*1)=93
93 % 10 = 3
So 91041-21-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H11NO3S/c1-15-12(14)11-10(6-7-17-11)16-9-5-3-2-4-8(9)13/h2-7H,13H2,1H3
