910444-68-7 Usage
General Description
2-(2,5-DIMETHOXYPHENYL)PIPERAZINE is a chemical compound that belongs to the class of piperazine derivatives. It is primarily known for its psychoactive effects and is commonly used in the research of central nervous system disorders and psychiatric conditions. The compound is also utilized in medicinal chemistry for its potential therapeutic properties, particularly in the treatment of anxiety, depression, and other mood disorders. 2-(2,5-DIMETHOXYPHENYL)PIPERAZINE has been studied for its interactions with various neurotransmitter systems, including serotonin and dopamine, and its potential as a pharmacological agent for modulating these pathways. Additionally, it has also been investigated for its potential in the development of novel drug candidates targeting these systems. Overall, the compound plays a significant role in both research and drug discovery in the field of neuropsychopharmacology.
Check Digit Verification of cas no
The CAS Registry Mumber 910444-68-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,0,4,4 and 4 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 910444-68:
(8*9)+(7*1)+(6*0)+(5*4)+(4*4)+(3*4)+(2*6)+(1*8)=147
147 % 10 = 7
So 910444-68-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H18N2O2/c1-15-9-3-4-12(16-2)10(7-9)11-8-13-5-6-14-11/h3-4,7,11,13-14H,5-6,8H2,1-2H3
