910444-70-1 Usage
General Description
2-(3,5-dimethoxyphenyl)piperazine is a chemical compound with the molecular formula C14H20N2O2. It belongs to the class of piperazine derivatives and is commonly used in medicinal chemistry as a building block in the synthesis of various pharmaceuticals. 2-(3,5-DIMETHOXYPHENYL)PIPERAZINE has been found to exhibit a range of biological activities, including potential antipsychotic, anxiolytic, and antidepressant properties. It has also been investigated for its potential use in the treatment of central nervous system disorders, such as schizophrenia and anxiety. Additionally, it has been studied for its potential as a serotonin receptor agonist and has shown promise as a potential therapeutic agent for various psychiatric and neurological conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 910444-70-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,0,4,4 and 4 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 910444-70:
(8*9)+(7*1)+(6*0)+(5*4)+(4*4)+(3*4)+(2*7)+(1*0)=141
141 % 10 = 1
So 910444-70-1 is a valid CAS Registry Number.
InChI:InChI=1/C12H18N2O2/c1-15-10-5-9(6-11(7-10)16-2)12-8-13-3-4-14-12/h5-7,12-14H,3-4,8H2,1-2H3
