91064-26-5 Usage
Uses
Used in Pharmaceutical Research and Development:
1-(3,5-Dichlorophenyl)-5-oxopyrrolidine-3-carboxylic acid is used as a building block for the synthesis of biologically active compounds, contributing to the development of new drugs and pharmaceutical products. Its unique structure allows it to be a key component in the creation of molecules with potential therapeutic applications.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 1-(3,5-Dichlorophenyl)-5-oxopyrrolidine-3-carboxylic acid is used as an intermediate in the synthesis of complex organic molecules. Its presence in these molecules can influence their pharmacological properties, making it an essential component in the design and synthesis of new therapeutic agents.
Used in Drug Synthesis:
1-(3,5-Dichlorophenyl)-5-oxopyrrolidine-3-carboxylic acid is used as a key intermediate in the synthesis of various drugs. Its chemical reactivity and structural features enable the production of pharmaceuticals with specific therapeutic targets and mechanisms of action.
Used in Chemical Synthesis Processes:
In chemical synthesis processes, 1-(3,5-Dichlorophenyl)-5-oxopyrrolidine-3-carboxylic acid is used as a versatile intermediate. Its ability to participate in various chemical reactions makes it suitable for the production of a wide range of chemical products, including those with applications in the pharmaceutical industry.
Used in Drug Design:
1-(3,5-Dichlorophenyl)-5-oxopyrrolidine-3-carboxylic acid is used in drug design to create novel pharmaceutical agents with improved efficacy, selectivity, and safety profiles. Its incorporation into drug candidates can lead to the development of innovative treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 91064-26-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,1,0,6 and 4 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 91064-26:
(7*9)+(6*1)+(5*0)+(4*6)+(3*4)+(2*2)+(1*6)=115
115 % 10 = 5
So 91064-26-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H9Cl2NO3/c12-7-2-8(13)4-9(3-7)14-5-6(11(16)17)1-10(14)15/h2-4,6H,1,5H2,(H,16,17)
91064-26-5Relevant academic research and scientific papers
The discovery of new plant activators and scaffolds with potential induced systemic resistance: From jasmonic acid to pyrrolidone
Chang, Kang,Shi, Yanxia,Chen, Jianqin,He, Zenghui,Xu, Zheng,Zhao, Zhenjiang,Zhu, Weiping,Li, Honglin,Xu, Yufang,Li, Baoju,Qian, Xuhong
, p. 1849 - 1857 (2016/09/23)
Plants can develop multifaceted system resistance as a result of infection with pathogens, insects, and some specific microbes or after treatment with specific chemicals.1 Among them, systemic acquired resistance (SAR) and induced systemic resi
