910649-59-1 Usage
Uses
Used in Pharmaceutical Research:
2-Chloro-3-hydroxy-5-picoline is used as a chemical intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows it to be a key component in the development of new drugs, particularly those targeting specific biological pathways or receptors.
Used in Chemical Research:
In the field of chemical research, 2-chloro-3-hydroxy-5-picoline serves as a valuable compound for studying the properties and reactions of heterocyclic organic compounds. It can be used to investigate the effects of substituents on the reactivity and stability of pyridine derivatives, contributing to the broader understanding of organic chemistry.
Used in Laboratory Settings:
2-Chloro-3-hydroxy-5-picoline is used as a reagent in various laboratory experiments, where its properties can be explored and utilized for the advancement of scientific knowledge. Its presence in professional laboratories highlights the importance of 2-CHLORO-3-HYDROXY-5-PICOLINE in the development of new methodologies and techniques in the field of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 910649-59-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,0,6,4 and 9 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 910649-59:
(8*9)+(7*1)+(6*0)+(5*6)+(4*4)+(3*9)+(2*5)+(1*9)=171
171 % 10 = 1
So 910649-59-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H6ClNO/c1-4-2-5(9)6(7)8-3-4/h2-3,9H,1H3
