91135-67-0 Usage
Uses
Used in Organic Synthesis:
3-(3-HYDROXY-QUINOXALIN-2-YL)-ACRYLIC ACID is used as a reactant in organic synthesis for the preparation of various other compounds. Its functional groups facilitate the formation of new chemical entities, contributing to the advancement of chemical libraries and the discovery of novel molecules with potential applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-(3-HYDROXY-QUINOXALIN-2-YL)-ACRYLIC ACID is used as a key intermediate in the synthesis of drugs. Its structural features allow for the development of molecules with specific biological activities, targeting various therapeutic areas.
Used in Agrochemical Industry:
3-(3-HYDROXY-QUINOXALIN-2-YL)-ACRYLIC ACID is utilized as a building block in the agrochemical industry for the synthesis of pesticides and other crop protection agents. Its chemical properties enable the creation of molecules with effective pest control properties, contributing to agricultural productivity and food security.
Used in Material Science:
In the field of material science, 3-(3-HYDROXY-QUINOXALIN-2-YL)-ACRYLIC ACID is used in the development of new materials. Its unique structure and functional groups can be exploited to create materials with specific properties, such as conductivity, magnetism, or optical characteristics, for various applications.
Used as a Fluorescent Probe in Biochemical Studies:
3-(3-HYDROXY-QUINOXALIN-2-YL)-ACRYLIC ACID is employed as a fluorescent probe in biochemical research. Its fluorescent properties allow for the tracking and visualization of biological processes, offering insights into cellular mechanisms and aiding in the study of molecular interactions.
Check Digit Verification of cas no
The CAS Registry Mumber 91135-67-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,1,1,3 and 5 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 91135-67:
(7*9)+(6*1)+(5*1)+(4*3)+(3*5)+(2*6)+(1*7)=120
120 % 10 = 0
So 91135-67-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H8N2O3/c14-10(15)6-5-9-11(16)13-8-4-2-1-3-7(8)12-9/h1-6H,(H,13,16)(H,14,15)/p-1/b6-5+
