911645-24-4 Usage
General Description
5-Chloro-2,4-difluorobenzeneboronic acid, 97% is a chemical compound that is used in various industrial and research applications. It is a boronic acid derivative with a high level of purity, at 97%. 5-Chloro-2,4-difluorobenzeneboronic acid, 97% is primarily used as a key building block in the synthesis of pharmaceuticals, agrochemicals, and materials science. Its unique structure and reactivity make it a valuable reagent in organic synthesis and drug discovery. Additionally, 5-Chloro-2,4-difluorobenzeneboronic acid, 97% can be used in the production of specialty chemicals and advanced materials due to its versatility and ability to participate in various chemical reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 911645-24-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,1,6,4 and 5 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 911645-24:
(8*9)+(7*1)+(6*1)+(5*6)+(4*4)+(3*5)+(2*2)+(1*4)=154
154 % 10 = 4
So 911645-24-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H4BClF2O2/c8-4-1-3(7(11)12)5(9)2-6(4)10/h1-2,11-12H
