911788-34-6 Usage
General Description
1-(1-ethyl-1H-pyrazol-3-yl)ethanamine is a chemical compound with the formula C7H12N2. It is an organic amine with a pyrazole ring and an ethyl group attached to the amine nitrogen. 1-(1-ethyl-1H-pyrazol-3-yl)ethanamine(SALTDATA: FREE) has various potential applications in pharmaceuticals, agrochemicals, and organic synthesis due to its unique structural features. It may be used as a building block for the synthesis of complex organic molecules and may also exhibit biological activity. Additionally, this compound has the potential to be used as a ligand in coordination chemistry due to its amine and pyrazole functional groups.
Check Digit Verification of cas no
The CAS Registry Mumber 911788-34-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,1,7,8 and 8 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 911788-34:
(8*9)+(7*1)+(6*1)+(5*7)+(4*8)+(3*8)+(2*3)+(1*4)=186
186 % 10 = 6
So 911788-34-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H13N3/c1-3-10-5-4-7(9-10)6(2)8/h4-6H,3,8H2,1-2H3
