91271-82-8 Usage
Uses
Used in Pharmaceutical Industry:
1-[2-(Morpholin-4-ylmethyl)phenyl]methanamine is used as a pharmaceutical intermediate for the development of new drugs, targeting a range of medical conditions. Its unique structure allows for its potential integration into various drug molecules, enhancing their therapeutic effects and pharmacological profiles.
Used in Organic Synthesis:
In the field of organic synthesis, 1-[2-(Morpholin-4-ylmethyl)phenyl]methanamine serves as a building block for creating new chemical compounds. Its morpholine-substituted phenylmethanamine structure provides a versatile platform for the synthesis of complex organic molecules with potential applications in various industries, including pharmaceuticals, materials science, and agrochemicals.
Further research is essential to fully understand the properties and potential applications of 1-[2-(Morpholin-4-ylmethyl)phenyl]methanamine, ensuring its safe and effective use in these industries.
Check Digit Verification of cas no
The CAS Registry Mumber 91271-82-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,1,2,7 and 1 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 91271-82:
(7*9)+(6*1)+(5*2)+(4*7)+(3*1)+(2*8)+(1*2)=128
128 % 10 = 8
So 91271-82-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H18N2O/c13-9-11-3-1-2-4-12(11)10-14-5-7-15-8-6-14/h1-4H,5-10,13H2/p+2
