912762-30-2 Usage
Uses
Used in Pharmaceutical Synthesis:
2-Chloro-5-thiophen-2-yl-pyrazine is used as a key intermediate in the synthesis of pharmaceuticals. Its unique structure allows it to be incorporated into the development of new drugs, potentially leading to innovative treatments for various medical conditions.
Used in Agrochemical Production:
In the agrochemical industry, 2-chloro-5-thiophen-2-yl-pyrazine serves as a crucial component in the creation of pesticides and other agricultural chemicals. Its incorporation can enhance the effectiveness of these products, contributing to improved crop protection and yield.
Used in Fine Chemicals Preparation:
2-CHLORO-5-THIOPHEN-2-YL-PYRAZINE is also utilized in the preparation of fine chemicals, which are high-purity chemicals used in various industries, including research, pharmaceuticals, and specialty applications. Its unique properties make it a valuable building block for creating high-quality specialty chemicals.
Used in Material Science:
2-Chloro-5-thiophen-2-yl-pyrazine has potential applications in material science due to its molecular structure and properties. It can be used to develop new materials with specific characteristics, such as improved conductivity or stability, for use in various industries.
Used in Electronics:
2-CHLORO-5-THIOPHEN-2-YL-PYRAZINE's unique properties also make it a promising candidate for use in the electronics industry. It can be employed in the development of electronic components or materials with enhanced performance, such as improved conductivity or resistance to environmental factors.
Check Digit Verification of cas no
The CAS Registry Mumber 912762-30-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,2,7,6 and 2 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 912762-30:
(8*9)+(7*1)+(6*2)+(5*7)+(4*6)+(3*2)+(2*3)+(1*0)=162
162 % 10 = 2
So 912762-30-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H5ClN2S/c9-8-5-10-6(4-11-8)7-2-1-3-12-7/h1-5H
