912773-12-7 Usage
General Description
2-AMINO-3-PYRROLIDIN-1-YLPYRAZINE is a chemical compound that consists of a pyrazine ring with an attached amino and pyrrolidinyl groups. It is commonly used in the field of organic chemistry as a building block for the synthesis of various pharmaceuticals and biologically active compounds. The presence of the amino and pyrrolidinyl groups in its structure gives 2-AMINO-3-PYRROLIDIN-1-YLPYRAZINE potential pharmacological and biological activities. Furthermore, it has been studied for its potential as an ingredient in food flavors and fragrances due to its unique aromatic characteristics. 2-AMINO-3-PYRROLIDIN-1-YLPYRAZINE has garnered interest in various scientific and industrial applications due to its versatile chemical structure and potential functional properties.
Check Digit Verification of cas no
The CAS Registry Mumber 912773-12-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,2,7,7 and 3 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 912773-12:
(8*9)+(7*1)+(6*2)+(5*7)+(4*7)+(3*3)+(2*1)+(1*2)=167
167 % 10 = 7
So 912773-12-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H12N4/c9-7-8(11-4-3-10-7)12-5-1-2-6-12/h3-4H,1-2,5-6H2,(H2,9,10)