913297-04-8 Usage
Description
2-(2-Chlorophenyl)morpholine oxalate is a chemical compound that is a derivative of morpholine and oxalic acid. It is a white to off-white crystalline solid with a molecular formula of C14H18ClNO4 and a molecular weight of 291.75 g/mol. Its structure and properties make it a useful reagent in the preparation of various drugs and related compounds.
Uses
Used in Pharmaceutical Industry:
2-(2-Chlorophenyl)morpholine oxalate is used as a pharmaceutical intermediate for the synthesis of various drugs and related compounds. Its unique structure allows it to be a key component in the development of new medications.
Used in Organic Synthesis:
2-(2-Chlorophenyl)morpholine oxalate is used as a reagent in organic synthesis for the preparation of a wide range of compounds. Its versatility and stability make it a valuable asset in the field of organic chemistry.
Used in Antifungal Treatments:
2-(2-Chlorophenyl)morpholine oxalate is being investigated for its potential use in antifungal treatments due to its structural resemblance to other bioactive compounds. Its ability to target and inhibit fungal growth could lead to the development of new antifungal medications.
Used in Anticancer Treatments:
2-(2-Chlorophenyl)morpholine oxalate is also being explored for its potential use in anticancer treatments. Its structural similarities to other bioactive compounds suggest that it may have the ability to target and inhibit cancer cell growth, leading to the development of new cancer therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 913297-04-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,3,2,9 and 7 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 913297-04:
(8*9)+(7*1)+(6*3)+(5*2)+(4*9)+(3*7)+(2*0)+(1*4)=168
168 % 10 = 8
So 913297-04-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H12ClNO.C2H2O4/c11-9-4-2-1-3-8(9)10-7-12-5-6-13-10;3-1(4)2(5)6/h1-4,10,12H,5-7H2;(H,3,4)(H,5,6)
