91339-19-4 Usage
Uses
Used in Chemical Synthesis Industry:
Benzenamine, 2,4-dimethyl-5-(1-methylethyl)is used as a key intermediate in the production of dyes, where it contributes to the formation of colorants through chemical reactions. Its unique structure allows for the creation of a wide range of dyes with different properties.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, Benzenamine, 2,4-dimethyl-5-(1-methylethyl)is employed as a building block for the synthesis of various medicinal compounds. Its presence in the molecular structure of these compounds can influence their therapeutic effects and pharmacological properties.
Used in Organic Compounds Production:
Benzenamine, 2,4-dimethyl-5-(1-methylethyl)is also utilized in the production of other organic compounds, where it serves as a versatile reactant or precursor. Its ability to participate in various chemical reactions makes it a valuable component in the synthesis of a diverse array of organic products.
Safety Precautions:
Given its potential hazards when ingested, inhaled, or absorbed through the skin, it is crucial to handle Benzenamine, 2,4-dimethyl-5-(1-methylethyl)with caution. Adequate safety measures, including the use of personal protective equipment and proper disposal methods, should be implemented to minimize risks associated with its use.
Check Digit Verification of cas no
The CAS Registry Mumber 91339-19-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,1,3,3 and 9 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 91339-19:
(7*9)+(6*1)+(5*3)+(4*3)+(3*9)+(2*1)+(1*9)=134
134 % 10 = 4
So 91339-19-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H17N/c1-7(2)11-8(3)5-6-10(12)9(11)4/h5-7H,12H2,1-4H3
