91345-58-3 Usage
Uses
Used in Organic Synthesis:
2,3,4,5,6-Pentamethylphenylmagnesium bromide is used as a reagent in organic synthesis for facilitating carbon-carbon bond formation. Its high reactivity allows it to participate in various chemical transformations, making it a valuable tool in the synthesis of complex organic molecules.
Used in Grignard Reactions:
In the field of organic chemistry, 2,3,4,5,6-Pentamethylphenylmagnesium bromide is used as a Grignard reagent for carrying out Grignard reactions. These reactions are crucial for the formation of new carbon-carbon bonds and are widely employed in the synthesis of a broad range of organic compounds, including pharmaceuticals, agrochemicals, and natural products.
Used in Carbon-Carbon Bond Formation:
2,3,4,5,6-Pentamethylphenylmagnesium bromide is utilized in reactions that involve the formation of carbon-carbon bonds, which are fundamental in constructing the backbones of many organic molecules. Its role in these reactions is essential for the creation of molecular complexity and diversity in organic chemistry.
Used in the Pharmaceutical Industry:
In the pharmaceutical industry, 2,3,4,5,6-Pentamethylphenylmagnesium bromide is used as a key intermediate in the synthesis of various drug molecules. Its ability to form carbon-carbon bonds makes it instrumental in the production of complex organic compounds with potential medicinal properties.
Used in the Agrochemical Industry:
Similarly, in the agrochemical industry, 2,3,4,5,6-Pentamethylphenylmagnesium bromide is employed in the synthesis of compounds with pesticidal or herbicidal activity. Its reactivity and utility in bond formation contribute to the development of new and effective agrochemical products.
Used in the Synthesis of Natural Products:
2,3,4,5,6-Pentamethylphenylmagnesium bromide is also used in the synthesis of complex natural products, which often have intricate molecular structures. Its role in facilitating carbon-carbon bond formation is invaluable in replicating or modifying the structures of these naturally occurring compounds for research and commercial purposes.
Check Digit Verification of cas no
The CAS Registry Mumber 91345-58-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,1,3,4 and 5 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 91345-58:
(7*9)+(6*1)+(5*3)+(4*4)+(3*5)+(2*5)+(1*8)=133
133 % 10 = 3
So 91345-58-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H15.BrH.Mg/c1-7-6-8(2)10(4)11(5)9(7)3;;/h1-5H3;1H;/q;;+1/p-1/rC11H15BrMg/c1-6-7(2)9(4)11(13-12)10(5)8(6)3/h1-5H3
