913835-33-3 Usage
Uses
Used in Organic Synthesis:
3-CYANO-5-NITROBENZENEBORONIC ACID 98 is used as a building block for the synthesis of complex organic compounds. Its reactivity allows it to participate in various chemical reactions, facilitating the creation of a wide range of organic molecules.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 3-CYANO-5-NITROBENZENEBORONIC ACID 98 is utilized as an important intermediate. Its role in forming stable boronate complexes makes it instrumental in the development of new pharmaceuticals, potentially leading to the discovery of novel drugs and therapeutic agents.
Used in Agrochemical Production:
3-CYANO-5-NITROBENZENEBORONIC ACID 98 also finds application in the agrochemical sector, where it serves as a key intermediate in the synthesis of various agrochemicals. Its use in this industry contributes to the development of new pesticides, herbicides, and other agricultural chemicals that are essential for modern farming practices.
Check Digit Verification of cas no
The CAS Registry Mumber 913835-33-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,3,8,3 and 5 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 913835-33:
(8*9)+(7*1)+(6*3)+(5*8)+(4*3)+(3*5)+(2*3)+(1*3)=173
173 % 10 = 3
So 913835-33-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H5BN2O4/c9-4-5-1-6(8(11)12)3-7(2-5)10(13)14/h1-3,11-12H
