913835-39-9 Usage
Uses
Used in Organic Synthesis:
4-(2-CHLORO-4-METHYLPHENYLCARBAMOYL)PHENYLBORONIC ACID is used as a reagent in organic synthesis for the preparation of various pharmaceuticals, agrochemicals, and materials. Its phenylboronic acid and carbamoyl groups enable the formation of carbon-carbon and carbon-heteroatom bonds, facilitating the synthesis of complex organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-(2-CHLORO-4-METHYLPHENYLCARBAMOYL)PHENYLBORONIC ACID is used as a key intermediate in the synthesis of new drugs and drug delivery systems. Its unique chemical properties allow for the development of innovative drug candidates with improved therapeutic efficacy and selectivity.
Used in Medicinal Chemistry:
4-(2-CHLORO-4-METHYLPHENYLCARBAMOYL)PHENYLBORONIC ACID is used as a building block in medicinal chemistry for the design and synthesis of new drugs. Its reactivity and functional groups enable the creation of novel molecular structures with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, 4-(2-CHLORO-4-METHYLPHENYLCARBAMOYL)PHENYLBORONIC ACID is used as a reagent in the synthesis of new agrochemicals, such as pesticides and herbicides. Its ability to form carbon-carbon and carbon-heteroatom bonds aids in the development of more effective and environmentally friendly agrochemicals.
Used in the Development of New Chemical Reactions and Methodologies:
4-(2-CHLORO-4-METHYLPHENYLCARBAMOYL)PHENYLBORONIC ACID is used as a key component in the development of new chemical reactions and methodologies for the formation of carbon-carbon and carbon-heteroatom bonds. Its unique reactivity and functional groups contribute to the advancement of synthetic chemistry and the discovery of new synthetic routes.
Check Digit Verification of cas no
The CAS Registry Mumber 913835-39-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,3,8,3 and 5 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 913835-39:
(8*9)+(7*1)+(6*3)+(5*8)+(4*3)+(3*5)+(2*3)+(1*9)=179
179 % 10 = 9
So 913835-39-9 is a valid CAS Registry Number.
InChI:InChI=1/C14H13BClNO3/c1-9-2-7-13(12(16)8-9)17-14(18)10-3-5-11(6-4-10)15(19)20/h2-8,19-20H,1H3,(H,17,18)
