913835-41-3 Usage
Uses
Used in Organic Synthesis:
4-(Benzyl(ethyl)carbamoyl)phenylboronic acid is used as a building block in organic synthesis for introducing boronic acid functionality into molecules, which enhances their reactivity and allows for the formation of new chemical bonds and structures.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 4-(Benzyl(ethyl)carbamoyl)phenylboronic acid is used as a key intermediate in the synthesis of pharmaceuticals. Its ability to form reversible covalent bonds with biological targets makes it a promising candidate for the development of drugs with novel mechanisms of action.
Used in Materials Science:
4-(Benzyl(ethyl)carbamoyl)phenylboronic acid is utilized in materials science for the design and synthesis of new materials with unique properties. The incorporation of boronic acid functionality can lead to the development of materials with enhanced stability, reactivity, or selectivity in various applications.
Used in Chemical Biology:
In chemical biology, 4-(Benzyl(ethyl)carbamoyl)phenylboronic acid is employed as a tool for studying the interactions between small molecules and biological systems. Its ability to form reversible covalent bonds allows for the investigation of molecular recognition processes and the development of probes for biological research.
Used in Pharmaceutical Development:
4-(Benzyl(ethyl)carbamoyl)phenylboronic acid is used in the development of pharmaceuticals as a building block for the synthesis of drug candidates. Its unique chemical properties and reactivity contribute to the discovery of new drugs with improved efficacy and selectivity.
Used in Agrochemical Development:
In the agrochemical industry, 4-(Benzyl(ethyl)carbamoyl)phenylboronic acid is used for the synthesis of novel agrochemicals, such as pesticides and herbicides. Its ability to form reversible covalent bonds with biological targets can lead to the development of more effective and targeted agrochemicals with reduced environmental impact.
Check Digit Verification of cas no
The CAS Registry Mumber 913835-41-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,3,8,3 and 5 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 913835-41:
(8*9)+(7*1)+(6*3)+(5*8)+(4*3)+(3*5)+(2*4)+(1*1)=173
173 % 10 = 3
So 913835-41-3 is a valid CAS Registry Number.
InChI:InChI=1/C16H18BNO3/c1-2-18(12-13-6-4-3-5-7-13)16(19)14-8-10-15(11-9-14)17(20)21/h3-11,20-21H,2,12H2,1H3
