913835-58-2 Usage
Uses
Used in Organic Synthesis:
3-Fluoro-4-(methoxycarbamoyl)benzeneboronic acid 97 is used as a key reagent in organic synthesis for the formation of carbon-carbon and carbon-heteroatom bonds. Its unique structure allows for the creation of diverse chemical entities, facilitating the development of new compounds with specific properties.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 3-Fluoro-4-(methoxycarbamoyl)benzeneboronic acid 97 serves as a building block in the development of pharmaceuticals. Its ability to form various chemical bonds makes it a valuable component in the synthesis of potential drug candidates, contributing to the discovery of novel therapeutic agents.
Used in Agrochemical Development:
3-Fluoro-4-(methoxycarbamoyl)benzeneboronic acid 97 is also utilized in the agrochemical industry as a starting material for the synthesis of bioactive compounds. Its reactivity and structural features enable the creation of new agrochemicals with improved efficacy and selectivity, supporting sustainable agriculture practices.
Used in Research Applications:
The high purity of 3-Fluoro-4-(methoxycarbamoyl)benzeneboronic acid 97 makes it an ideal compound for research purposes. It is used in academic and industrial research settings to explore its chemical properties, reactivity, and potential applications in various chemical and biological processes.
Check Digit Verification of cas no
The CAS Registry Mumber 913835-58-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,3,8,3 and 5 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 913835-58:
(8*9)+(7*1)+(6*3)+(5*8)+(4*3)+(3*5)+(2*5)+(1*8)=182
182 % 10 = 2
So 913835-58-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H9BFNO4/c1-15-11-8(12)6-3-2-5(9(13)14)4-7(6)10/h2-4,13-14H,1H3,(H,11,12)
