913835-79-7 Usage
Uses
Used in Organic Synthesis:
3-(Hydrazinecarbonyl)benzenboronic acid 97 is used as a reagent for its ability to participate in the formation of carbon-carbon bonds, which is essential in creating complex organic molecules. Its reactivity makes it a key component in various organic synthesis processes.
Used in Pharmaceutical Production:
In the pharmaceutical industry, 3-(Hydrazinecarbonyl)benzenboronic acid 97 is utilized as a building block for the synthesis of different medicinal compounds. Its unique structure and reactivity contribute to the development of new drugs with potential therapeutic applications.
Used in Chemical Research:
3-(Hydrazinecarbonyl)benzenboronic acid 97 is also employed in research settings to explore its properties and potential reactions, further expanding the understanding of boronic acid derivatives and their role in organic chemistry. This research can lead to the discovery of new applications and improvements in existing chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 913835-79-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,3,8,3 and 5 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 913835-79:
(8*9)+(7*1)+(6*3)+(5*8)+(4*3)+(3*5)+(2*7)+(1*9)=187
187 % 10 = 7
So 913835-79-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H9BN2O3/c9-10-7(11)5-2-1-3-6(4-5)8(12)13/h1-4,12-13H,9H2,(H,10,11)
