913836-03-0 Usage
Uses
Used in Organic Synthesis:
5-Carboxypyridine-3-boronic acid is used as a building block in organic synthesis for its ability to participate in Suzuki-Miyaura coupling reactions, which are crucial for the formation of carbon-carbon bonds. This application is essential for the creation of complex organic molecules and contributes to the advancement of chemical research and development.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 5-Carboxypyridine-3-boronic acid is utilized as a key component in the development of new pharmaceutical drugs. Its boronic acid moiety can interact with specific biological targets, making it a valuable asset in the design and synthesis of novel therapeutic agents.
Used in Fluorescent Probe Development for Biological Imaging:
5-Carboxypyridine-3-boronic acid has been studied for its potential use in the development of fluorescent probes for imaging biological systems. Its incorporation into these probes allows for the visualization and analysis of cellular processes and structures, providing valuable insights into biological functions and contributing to the understanding of various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 913836-03-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,3,8,3 and 6 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 913836-03:
(8*9)+(7*1)+(6*3)+(5*8)+(4*3)+(3*6)+(2*0)+(1*3)=170
170 % 10 = 0
So 913836-03-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H6BNO4/c9-6(10)4-1-5(7(11)12)3-8-2-4/h1-3,11-12H,(H,9,10)
