913836-06-3 Usage
Uses
Used in Pharmaceutical Synthesis:
4-(2-BROMOETHOXY)PHENYLBORONIC ACID is used as a building block for the synthesis of various pharmaceuticals. Its unique structure allows for the formation of carbon-carbon bonds through the Suzuki-Miyaura coupling reaction, enabling the creation of complex molecular structures with potential therapeutic properties.
Used in Agrochemical Synthesis:
In the agrochemical industry, 4-(2-BROMOETHOXY)PHENYLBORONIC ACID is used as a key intermediate in the synthesis of various agrochemicals. Its ability to form carbon-carbon bonds through the Suzuki-Miyaura coupling reaction contributes to the development of new and effective compounds for crop protection and pest control.
Used in Material Synthesis:
4-(2-BROMOETHOXY)PHENYLBORONIC ACID is also utilized in the synthesis of advanced materials, such as polymers and composites. Its reactivity in the Suzuki-Miyaura coupling reaction allows for the creation of novel materials with improved properties, such as enhanced stability, durability, or specific functional groups.
Used in Organic Synthesis:
As a versatile reagent in organic synthesis, 4-(2-BROMOETHOXY)PHENYLBORONIC ACID is used for the formation of carbon-carbon bonds through the Suzuki-Miyaura coupling reaction. This reaction is widely employed in the synthesis of various organic compounds, including natural products, pharmaceuticals, agrochemicals, and other specialty chemicals, making it a valuable tool for chemists in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 913836-06-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,3,8,3 and 6 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 913836-06:
(8*9)+(7*1)+(6*3)+(5*8)+(4*3)+(3*6)+(2*0)+(1*6)=173
173 % 10 = 3
So 913836-06-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H10BBrO3/c10-5-6-13-8-3-1-7(2-4-8)9(11)12/h1-4,11-12H,5-6H2
