913836-08-5 Usage
Uses
Used in Organic Synthesis:
2-Chloro-4-methylpyridine-5-boronic acid is used as a synthetic building block for the creation of a diverse range of organic molecules. Its boronic acid functional group facilitates reactions such as Suzuki-Miyaura cross-coupling, which is instrumental in the formation of carbon-carbon bonds, thereby expanding the scope of molecular structures that can be synthesized.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2-Chloro-4-methylpyridine-5-boronic acid is utilized as a potential pharmaceutical intermediate. Its unique structure and reactivity make it a valuable component in the design and synthesis of new drugs and therapeutic agents. Researchers leverage its properties to explore its potential in the development of novel treatments for various diseases and conditions.
Used in Medicinal Chemistry:
2-Chloro-4-methylpyridine-5-boronic acid serves as a key tool for chemists and researchers in medicinal chemistry. Its ability to participate in various chemical reactions allows for the modification and optimization of drug candidates, enhancing their efficacy, selectivity, and pharmacokinetic properties.
Overall, 2-Chloro-4-methylpyridine-5-boronic acid is a multifaceted compound with broad applications across different sectors of chemical and pharmaceutical sciences, underpinning its significance in modern drug discovery and development processes.
Check Digit Verification of cas no
The CAS Registry Mumber 913836-08-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,3,8,3 and 6 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 913836-08:
(8*9)+(7*1)+(6*3)+(5*8)+(4*3)+(3*6)+(2*0)+(1*8)=175
175 % 10 = 5
So 913836-08-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H7BClNO2/c1-4-2-6(8)9-3-5(4)7(10)11/h2-3,10-11H,1H3
