914206-75-0 Usage
Uses
Used in Pharmaceutical Industry:
6-Chloropyrazolo[1,5-a]pyrimidine-2-carboxylic acid is used as a building block for the synthesis of various pharmaceutical products. Its unique chemical structure and potential pharmacological properties make it a valuable component in the development of new drugs for the treatment of various diseases and disorders.
Used in Agrochemical Industry:
In the agrochemical industry, 6-chloropyrazolo[1,5-a]pyrimidine-2-carboxylic acid is used as a building block in the synthesis of agrochemicals. Its potential applications include the development of new pesticides, herbicides, and other agricultural chemicals to improve crop yield and protect plants from pests and diseases.
Used as a Reagent in Organic Synthesis:
6-Chloropyrazolo[1,5-a]pyrimidine-2-carboxylic acid is also used as a reagent in organic synthesis. Its unique chemical properties allow it to participate in various chemical reactions, facilitating the synthesis of complex organic compounds for research and industrial applications.
Used in Medicinal Chemistry Research:
6-Chloropyrazolo[1,5-a]pyrimidine-2-carboxylic acid is an important compound in medicinal chemistry research. Its potential therapeutic applications are being studied extensively, with the aim of discovering new treatments for various diseases and disorders. Researchers are exploring its interactions with biological targets and evaluating its efficacy and safety in preclinical and clinical studies.
Check Digit Verification of cas no
The CAS Registry Mumber 914206-75-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,4,2,0 and 6 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 914206-75:
(8*9)+(7*1)+(6*4)+(5*2)+(4*0)+(3*6)+(2*7)+(1*5)=150
150 % 10 = 0
So 914206-75-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H4ClN3O2/c8-4-2-9-6-1-5(7(12)13)10-11(6)3-4/h1-3H,(H,12,13)
914206-75-0Relevant academic research and scientific papers
PYRAZOLOPYRIMIDINES, A PROCESS FOR THEIR PREPARATION AND THEIR USE OF MEDICINE
-
Page/Page column 21, (2008/06/13)
Substituted pyrazolopyrimidine derivatives of formula (I) wherein R1 represents chloro or bromo; R2, R3, R4, R5, R6 and R7 independently represent e.g. hydrogen or C1-6-alkyl; R8 represents a radical R9 or a radical R10, whereby one of the two radicals R8 represents R9 and the other radical R8 represents Ret; R9 represents e.g. a phenyl or thiophene group, and R10 represents e.g. hydrogen or methyl; are potent mGluR5 modulators and are useful for the prevention of acute and chronic neurological disorders.
