914347-40-3 Usage
Uses
Used in Pharmaceutical Research and Synthesis:
4-Oxazolecarboxylic acid, 2-amino-5-bromo-, ethyl ester is used as a building block for the creation of various bioactive molecules. Its unique structure and functional groups make it a valuable component in the design and synthesis of new pharmaceutical agents.
Used in Drug Discovery and Development:
4-Oxazolecarboxylic acid, 2-amino-5-bromo-, ethyl ester is utilized in the discovery and development of new drugs, contributing to the advancement of medicinal chemistry. Its presence in the synthesis process can lead to the creation of innovative therapeutic agents with improved efficacy and selectivity.
Used in Organic Chemistry Reactions:
4-Oxazolecarboxylic acid, 2-amino-5-bromo-, ethyl ester is employed as a reagent in various organic chemistry reactions, facilitating the formation of complex molecular structures and aiding in the synthesis of target compounds.
Used in the Synthesis of Novel Compounds for Medicinal Purposes:
In the field of medicinal chemistry, this ethyl ester is used to synthesize novel compounds with potential therapeutic applications. Its incorporation into the molecular framework of these compounds can enhance their pharmacological properties, leading to the development of new treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 914347-40-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,4,3,4 and 7 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 914347-40:
(8*9)+(7*1)+(6*4)+(5*3)+(4*4)+(3*7)+(2*4)+(1*0)=163
163 % 10 = 3
So 914347-40-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H7BrN2O3/c1-2-11-5(10)3-4(7)12-6(8)9-3/h2H2,1H3,(H2,8,9)
