914347-73-2 Usage
Uses
Used in Pharmaceutical Industry:
5-BROMO-2-(PIPERIDIN-3-YLOXY)PYRIMIDINE is used as a building block for the development of new drugs due to its unique chemical structure and potential biological activity.
Used in Chemical Industry:
5-BROMO-2-(PIPERIDIN-3-YLOXY)PYRIMIDINE is used as a reagent in organic chemistry reactions, contributing to the synthesis of other organic compounds.
Used in Research and Development:
5-BROMO-2-(PIPERIDIN-3-YLOXY)PYRIMIDINE is utilized in research and testing to fully understand and characterize its properties and potential uses, including its biological activity and applications in drug development. Further studies are needed to explore its full potential in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 914347-73-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,4,3,4 and 7 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 914347-73:
(8*9)+(7*1)+(6*4)+(5*3)+(4*4)+(3*7)+(2*7)+(1*3)=172
172 % 10 = 2
So 914347-73-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H12BrN3O/c10-7-4-12-9(13-5-7)14-8-2-1-3-11-6-8/h4-5,8,11H,1-3,6H2
