914348-92-8 Usage
General Description
2-(2,4-Dichloro-5-fluorophenyl)piperazine is a synthetic organic compound that contains a piperazine substructure, which is a six-membered ring containing two nitrogen atoms at opposite positions. It's a derivative of phenylpiperazines, a broad class of compounds known for their psychoactive and pharmacological properties. The exact characteristics and applications of this specific compound vary and can likely be developed for various chemical or pharmaceutical uses, but it generally shares the common properties of other phenylpiperazines. Its elemental structure includes chlorine, fluorine, and nitrogen atoms, which can greatly influence its reactivity, polarity and other chemical attributes. Major identified areas of use for similar compounds include fields like medicinal chemistry, particularly psychopharmacology, as well as materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 914348-92-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,4,3,4 and 8 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 914348-92:
(8*9)+(7*1)+(6*4)+(5*3)+(4*4)+(3*8)+(2*9)+(1*2)=178
178 % 10 = 8
So 914348-92-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H11Cl2FN2/c11-7-4-8(12)9(13)3-6(7)10-5-14-1-2-15-10/h3-4,10,14-15H,1-2,5H2
