914358-72-8 Usage
Uses
Used in Pharmaceutical Industry:
5-BROMO-3-CHLORO-2-METHYLPYRIDINE is used as a key intermediate for the synthesis of various pharmaceutical compounds. Its unique structure and functional groups enable the creation of diverse organic compounds, making it a valuable building block in the development of new drugs.
Used in Agrochemical Industry:
5-BROMO-3-CHLORO-2-METHYLPYRIDINE is utilized as a versatile intermediate in the synthesis of agrochemicals. Its reactivity and functional groups allow for the production of a wide range of agrochemicals, contributing to the development of effective and innovative products for agricultural applications.
Used in Specialty Chemicals Industry:
5-BROMO-3-CHLORO-2-METHYLPYRIDINE is employed as a crucial building block in the synthesis of specialty chemicals. Its unique structure and functional groups make it an essential component in the production of various specialty chemicals, enhancing their properties and applications.
Used in Organic Synthesis:
5-BROMO-3-CHLORO-2-METHYLPYRIDINE is used as a reagent in organic synthesis. Its high reactivity and functional groups make it a valuable tool for the creation of diverse chemical compounds, facilitating the development of new and innovative molecules.
Used in Medicinal Chemistry:
5-BROMO-3-CHLORO-2-METHYLPYRIDINE is utilized as a reagent in medicinal chemistry. Its unique structure and functional groups make it an important component in the development of new and innovative molecules, contributing to the advancement of pharmaceutical research and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 914358-72-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,4,3,5 and 8 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 914358-72:
(8*9)+(7*1)+(6*4)+(5*3)+(4*5)+(3*8)+(2*7)+(1*2)=178
178 % 10 = 8
So 914358-72-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H5BrClN/c1-4-6(8)2-5(7)3-9-4/h2-3H,1H3
914358-72-8Relevant academic research and scientific papers
Compounds and their use as BACE Inhibitors
-
Page/Page column 32, (2012/07/13)
The present invention relates to compounds of formula (I) and their pharmaceutical compositions. In addition, the present invention relates to therapeutic methods for the treatment and/or prevention of Aβ-related pathologies such as Down's syndrome, β-amyloid angiopathy such as but not limited to cerebral amyloid angiopathy or hereditary cerebral hemorrhage, disorders associated with cognitive impairment such as but not limited to MCI (“mild cognitive impairment”), Alzheimer's disease, memory loss, attention deficit symptoms associated with Alzheimer's disease, neurodegeneration associated with diseases such as Alzheimer's disease or dementia including dementia of mixed vascular and degenerative origin, pre-senile dementia, senile dementia and dementia associated with Parkinson's disease, progressive supranuclear palsy or cortical basal degeneration.