914636-91-2 Usage
Uses
Used in Organic Synthesis:
Benzene, 1-bromo-2,4-difluoro-5-iodois used as a building block in organic synthesis for introducing specific functional groups into target molecules. Its unique combination of halogens allows for selective reactions and modifications, facilitating the creation of complex organic compounds.
Used in Chemical Research:
Benzene, 1-bromo-2,4-difluoro-5-iodoserves as a valuable tool in chemical research, particularly in the study of halogenated aromatic systems and their reactivity. It helps researchers understand the effects of different halogens on the benzene ring and their influence on chemical properties and reactions.
Used as a Precursor in Industrial Applications:
Benzene, 1-bromo-2,4-difluoro-5-iodois utilized as a precursor to other fluorinated and iodinated compounds, which find use in various industries such as pharmaceuticals, agrochemicals, and materials science. Its ability to be further modified and functionalized makes it a key intermediate in the synthesis of specialized compounds.
Used in Pharmaceutical Development:
In the pharmaceutical industry, Benzene, 1-bromo-2,4-difluoro-5-iodois employed as a starting material for the development of new drugs and medicinal agents. Its unique structural features can be exploited to design molecules with specific biological activities, potentially leading to the discovery of novel therapeutic agents.
It is crucial to handle Benzene, 1-bromo-2,4-difluoro-5-iodowith care due to its potential hazards and harmful effects on human health and the environment. Proper safety measures and disposal methods should be followed to minimize risks associated with its use.
Check Digit Verification of cas no
The CAS Registry Mumber 914636-91-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,4,6,3 and 6 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 914636-91:
(8*9)+(7*1)+(6*4)+(5*6)+(4*3)+(3*6)+(2*9)+(1*1)=182
182 % 10 = 2
So 914636-91-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H2BrF2I/c7-3-1-6(10)5(9)2-4(3)8/h1-2H
